Carbaryl

Origem: Wikipédia, a enciclopédia livre.
Ir para: navegação, pesquisa
Carbaryl

O carbaryl (1-naftil metilcarbamato, número CAS 63-25-2) é um químico da família dos carbamatos, usado principalmente como insecticida.

A sua fórmulas SMILES é S=CNC(OC2=CC=CC1=CC=CC=C12)=O

Wiki letter w.svg Este artigo é um esboço. Você pode ajudar a Wikipédia expandindo-o. Editor: considere marcar com um esboço mais específico.