
Origem: Wikipédia, a enciclopédia livre.
Ir para: navegação, pesquisa
Alerta sobre risco à saúde
DC chemical structure.png
Número CAS 951-77-9
PubChem 637
ChemSpider 13117
MeSH Deoxycytidine
InChI InChI=1/C9H13N3O4/c10-7-1-2-12(9(15)11-7)8-3-5(14)6(4-13)16-8/h1-2,5-6,8,13-14H,3-4H2,(H2,10,11,15)/t5-,6+,8+/m0/s1
Fórmula molecular C9H13N3O4
Massa molar 227.217
Excepto onde denotado, os dados referem-se a
materiais sob condições PTN

Referências e avisos gerais sobre esta caixa.
Alerta sobre risco à saúde.

Desoxicitidina é um desoxirribonucleosídeo. Ela é a molécula formada pela ligação da citosina com a desoxirribose.