
Origem: Wikipédia, a enciclopédia livre.
Ir para: navegação, pesquisa
Alerta sobre risco à saúde
Nome IUPAC (1R,2S)-2-(Dimetilamino)-1-fenil-1-propanol
Outros nomes N-Metil-L-efedrina
Número CAS 552-79-4
PubChem 64782
ChemSpider 58315
InChI InChI=1/C11H17NO/c1-9(12(2)3)11(13)10-7-5-4-6-8-10/h4-9,11,13H,1-3H3/t9-,11-/m0/s1
Fórmula química C11H17NO
Massa molar 179.25 g mol-1
Ponto de fusão

87-87.5 °C[1]
192 °C (HCl)[1]

Solubilidade em água Readily soluble[1]
Compostos relacionados
Compostos relacionados Efedrina
Excepto onde denotado, os dados referem-se a
materiais sob condições PTN

Referências e avisos gerais sobre esta caixa.
Alerta sobre risco à saúde.

N-Metilefedrina é um derivado da efedrina. Foi isolado da Ephedra distachya.[2]


  1. a b c Merck Index, 11th Edition, 5987
  2. Smith. (1927). "CCLXX. l-Methylephedrine, an alkaloid from Ephedra species". J. Chem. Soc.: 2056 pp.. DOI:10.1039/jr9270002056.