Mostrar código-fonte de Hexacarbonila de molibdênio


{{Chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 268875245
| ImageFileL1 = Molybdenum-hexacarbonyl-2D.png
| ImageFileL1_Ref = {{chemboximage|correct|??}}
| ImageSizeL1 = 
| ImageNameL1 = Stereo, skeletal formula of molybdenum hexacarbonyl
| ImageFileR1 = Molybdenum-hexacarbonyl-from-xtal-3D-balls.png
| ImageFileR1_Ref = {{chemboximage|correct|??}}
| ImageSizeR1 = 
| ImageNameR1 = Ball and stick model of molybdenum hexacarbonyl
| ImageFile2 = Mocarbonyl.JPG
| ImageFile2_Ref = {{chemboximage|correct|??}}
| ImageSize2 = 
| ImageName2 = Sample of molybdenum hexacarbonyl
| IUPACName = Hexacarbonilmolibdênio(0)
| SystematicName = Hexacarbonilmolibdênio<ref>{{citar web|título= Hexacarbonylmolybdenum (CHEBI:30508) | url = https://www.ebi.ac.uk/chebi/searchId.do?chebiId=30508 |obra= Chemical Entities of Biological Interest (ChEBI) |local= UK |publicado= European Bioinformatics Institute }}</ref>
|Section1={{Chembox Identifiers
| CASNo = 13939-06-5
| CASNo_Ref = {{cascite|correct|CAS}}
| PubChem = 98885
| ChemSpiderID = 21428397
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| EINECS = 237-713-3
| UNNumber = 3466
| MeSHName = Hexacarbonylmolybdenum
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI = 30508
| Gmelin = 3798, 562210
| SMILES = [O]#C[Mo](C#[O])(C#[O])(C#[O])(C#[O])C#[O]
| StdInChI = 1S/6CO.Mo/c6*1-2;
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = KMKBZNSIJQWHJA-UHFFFAOYSA-N
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
}}
|Section2={{Chembox Properties
| C=6 | Mo=1 | O=6
| Appearance = Vivid, white, translucent crystals
| Density = 1.96 g cm<sup>−3</sup>
| MeltingPtC = 150
| BoilingPtC = 156
}}
|Section3={{Chembox Structure
| CrystalStruct = Orthogonal
| Coordination = Octahedral
| Dipole = 0 D
}}
|Section4={{Chembox Thermochemistry
| DeltaHf = -989.1 kJ mol<sup>−1</sup>
| DeltaHc = -2123.4 kJ mol<sup>−1</sup>
}}
|Section5={{Chembox Hazards
| ExternalSDS = [http://ptcl.chem.ox.ac.uk/MSDS/HE/hexacarbonylmolybdenum.html External MSDS]
| EUClass = {{Hazchem T+}}
| RPhrases = {{R26/27/28}}
| SPhrases = {{S1/2}}, {{S36/37/39}}, {{S45}}
}}
|Section6={{Chembox Related
| OtherCompounds = [[Hexacarbonila de cromo]]<br />
[[Hexacarbonila de tungstênio]]
}}
}}
'''Hexacarbonila de molibdênio''' é um [[composto inorgânico]] de [[fórmula química]] Mo(CO)<sub>6</sub>.  Este sólido incolor, como os análogos de crómio e tungsténio, é notável como um derivado volátil.<ref>{{Citar periódico|titulo = Organometallic bond dissociation energies: laser pyrolysis of iron pentacarbonyl, chromium hexacarbonyl, molybdenum hexacarbonyl, and tungsten hexacarbonyl|url = http://dx.doi.org/10.1021/ja00326a004|jornal = Journal of the American Chemical Society|data = 1984-07-01|issn = 0002-7863|paginas = 3905-3912|volume = 106|numero = 14|doi = 10.1021/ja00326a004|primeiro = Karan E.|ultimo = Lewis|coautores = David M.}}</ref>

{{Referências}}


{{Esboço-composto-inorgânico}}

[[Categoria:Compostos de molibdênio]]