Mostrar código-fonte de Gulose

{{Info/Química
 |   Name   = Gulose
 |   ImageFile = Gulose.svg
 |   ImageSize = 200px
 |   ImageName =
 |   ImageFile1 = DL-Gulose.svg
 |   ImageSize1 = 200px
 |   ImageName1 =
 | IUPACName = 6-(hidroximetil)oxano-<br />2,3,4,5-tetrol
 | OtherNames =
 | Section1 = {{Chembox Identifiers
 |   CASNo  = 4205-23-6
 |   CASOther = (<small>D-</small>gulose)<br /> 6027-89-0 (<small>L-</small>gulose)
 |   PubChem = 167792
 |   SMILES = O=C[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO
 |   MeSHName =
  }}
 | Section2 = {{Chembox Properties
 |   Formula = C<sub>6</sub>H<sub>12</sub>O<sub>6</sub>
 |   MolarMass = 180.16 g/mol
 |  MeltingPt = 132 °C<ref name="Acros_L">{{Acros|37682|Name=<small>L</small>-(+)-Gulose|Datum=19. Februar 2010}}</ref>
 |  Solubility = solúvel<ref name="roempp">Arne Lützen in: ''Römpp Online - Version 3.5'', '''2009''', Georg Thieme Verlag, Stuttgart.</ref>
 |  SolubleOther = solúvel em [[etanol]]<ref name="roempp" />
  }}
 | Section7 = {{Chembox Hazards
 |   MainHazards =
 |   FlashPt =
 |   Autoignition =
 |  RPhrases = -
 |  SPhrases = {{S24/25}}
  }}
 | Section8 = {{Chembox Related
 |   Function = [[Monossacarídeo]]s
 |   OtherFunctn = [[Galactose]], [[glicose]] e [[manose]] (aldoexoses)<br />[[Frutose]] e [[psicose (carboidrato)|psicose]] (cetoexoses)<br />[[Fucose]] e [[ramnose]] (desoxiaçúcares)
  }}
}}
A '''gulose''' é um [[monossacarídeo]] do tipo [[hexose]], de fórmula química C<sub>6</sub>H<sub>12</sub>O<sub>6</sub>. Faz parte do grupo das [[aldose]]s. Possui a consistência de um xarope e sabor adocicado.

A gulose é um açúcar muito raro na natureza, mas pode ser encontrada em algumas [[Archaea|arqueobactérias]].<ref>Swain, M., Brisson, J. R., Sprott, G. D., Cooper, F. P. and Patel, G. B. (1997). "[http://www.ncbi.nlm.nih.gov/pubmed/9084501 Identification of beta-L-gulose as the sugar moiety of the main polar lipid Thermoplasma acidophilum.]" ''Biochim. Biophys.'' Acta '''1345''' (1): 56–64.</ref>

{{Referências}}
{{esboço-composto-orgânico}}
{{Carboidratos}}
{{Portal3|Química|Bioquímica}}
{{Controle de autoridade}}

[[Categoria:Aldo-hexoses]]