
Origem: Wikipédia, a enciclopédia livre.
Ir para: navegação, pesquisa
Alerta sobre risco à saúde
Nome IUPAC (2S)-2-(3,4-Diidrofenil)-5,7-diidroxi-4-cromanona
Outros nomes Eriodictiol
Número CAS 552-58-9
PubChem 440735
ChemSpider 389606
InChI InChI=1/C15H12O6/c16-8-4-11(19)15-12(20)6-13(21-14(15)5-8)7-1-2-9(17)10(18)3-7/h1-5,13,16-19H,6H2/t13-/m0/s1
Fórmula molecular C15H12O6
Massa molar 288.25 g/mol
Excepto onde denotado, os dados referem-se a
materiais sob condições PTN

Referências e avisos gerais sobre esta caixa.
Alerta sobre risco à saúde.

Eriodictiol é uma flavanona, um flavonoide extraído da Yerba Santa (Eriodictyon californicum), uma planta nativa da América do Norte.[1]


  1. Patricia Kaminski and Richard Katz. Yerba Santa Eriodictyon californicum. Flower Essence Society.