Deptropina

Origem: Wikipédia, a enciclopédia livre.
Saltar para a navegação Saltar para a pesquisa
Estrutura química de Deptropina
Deptropina
Star of life caution.svg Aviso médico
Nome IUPAC (sistemática)
3a-[(10,11-dihydro-5H-dibenzo[a,d]cyclohepten-5-yl)
oxy]1aH,5aH-tropane
Identificadores
CAS 604-51-3
ATC R06AX16
PubChem 16576
ChemSpider 16735768
Informação química
Fórmula molecular C23H27NO 
Massa molar 333.467 g/mol
SMILES CN5[C@@H]1CC[C@H]5C[C@H](C1)OC3c4ccccc4CCc2ccccc23
Farmacocinética
Biodisponibilidade ?
Metabolismo ?
Meia-vida ?
Excreção ?
Considerações terapêuticas
Administração ?
DL50 ?

Deptropina (Brontina) também conhecida como dibenzeptropina, é um anti-histamínico com propriedades anticolinérgicas. É normalmente comercializado na forma do sal citrato.[1]

Ver também[editar | editar código-fonte]

Referências