
Origem: Wikipédia, a enciclopédia livre.
Ir para: navegação, pesquisa
Alerta sobre risco à saúde
DG chemical structure.png
Nome IUPAC 2-Amino-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H-purin-6-one
Número CAS 961-07-9
PubChem 638
ChemSpider 163230
MeSH Deoxyguanosine
InChI InChI=1/C10H13N5O4/c11-10-13-8-7(9(18)14-10)12-3-15(8)6-1-4(17)5(2-16)19-6/h3-6,16-17H,1-2H2,(H3,11,13,14,18)/t4-,5+,6+/m0/s1
Fórmula molecular C10H13N5O4
Massa molar 267.24 g/mol
Compostos relacionados
Compostos relacionados Guanina
Desoxiguanosina monofosfato (fosfato na posição 5')
Excepto onde denotado, os dados referem-se a
materiais sob condições PTN

Referências e avisos gerais sobre esta caixa.
Alerta sobre risco à saúde.

Desoxiguanosina é um nucleosídeo, semelhante à guanosina, mas com uma hidroxila removida da posição 2' da ribose. Assim como a guanosina é uma ribose ligada à guanina, este composto é uma desoxirribose ligada à guanina.

Ver também[editar | editar código-fonte]