Drofenina

Origem: Wikipédia, a enciclopédia livre.
Saltar para a navegação Saltar para a pesquisa
Estrutura química de Drofenina
Drofenina
Star of life caution.svg Aviso médico
Nome IUPAC (sistemática)
2-(diethylamino)ethyl 2-cyclohexyl-2-phenylacetate
Identificadores
CAS (Cloridrato)&rn=1 548-66-3 (Cloridrato)
ATC A03EA05
PubChem 3166
Informação química
Fórmula molecular C20H31NO2 
Massa molar 317,47 g/mol
SMILES CCN(CC)CCOC(=O)C(C1CCCCC1)C2=CC=CC=C2
Sinónimos Cicloadifeno;
Adifenina H;
Trasentina-6H;
Hexaidroadifenina;
Cicloadifenina
Farmacocinética
Biodisponibilidade ?
Metabolismo ?
Meia-vida ?
Excreção ?
Considerações terapêuticas
Administração ?
DL50 ?

Drofenina [nome comercial: Spasmoplus (A)] é um princípio ativo usado como um espasmolítico patenteado pela Ciba em 1941. É um anticolinérgico que atua tanto no nível dos nervos quanto nas fibras musculares (efeito neurotrópico-musculotrópico). A drofenina também atua como FIASMA (inibidor funcional da esfingomielinase ácida).[1][2]

Quimicamente, é um derivado do ácido fenilacético, que está relacionado à adifenina.[3][4]

A droga é utilizada na forma de cloridrato.[5]

Referências

  1. Kornhuber J, Muehlbacher M, Trapp S, Pechmann S, Friedl A, Reichel M, Mühle C, Terfloth L, Groemer T, Spitzer G, Liedl K, Gulbins E, Tripal P (2011). «Identification of novel functional inhibitors of acid sphingomyelinase». PLoS ONE. 6 (8): e23852. doi:10.1371/journal.pone.0023852 
  2. Drofenine - www.drugs.com
  3. Adiphenine - PubChem
  4. Drofenine - PubChem
  5. Drofenine - www.drugfuture.com